C12H11FN2O5S — CID 603741
1-(4-ethoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione (PubChem CID 603741) has the molecular formula C12H11FN2O5S and a molecular weight of 314.29 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 603741 |
| Molecular Formula | C12H11FN2O5S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione |
| SMILES | CCOc1ccc(S(=O)(=O)n2cc(F)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H11FN2O5S/c1-2-20-8-3-5-9(6-4-8)21(18,19)15-7-10(13)11(16)14-12(15)17/h3-7H,2H2,1H3,(H,14,16,17) |
| InChIKey | JYXNKDQEQDBBMR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |