C19H25F2N3O6S — CID 87239672
3-(2,2-difluoroethoxy)-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide (PubChem CID 87239672) has the molecular formula C19H25F2N3O6S and a molecular weight of 461.49 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87239672 |
| Molecular Formula | C19H25F2N3O6S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(CCCOCn1ccc(=O)[nH]c1=O)NS(=O)(=O)c1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C19H25F2N3O6S/c1-19(2,8-4-10-29-13-24-9-7-17(25)22-18(24)26)23-31(27,28)15-6-3-5-14(11-15)30-12-16(20)21/h3,5-7,9,11,16,23H,4,8,10,12-13H2,1-2H3,(H,22,25,26) |
| InChIKey | YEXKMPZVKFRICD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|