C18H25N3O6S — CID 57386528
N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]-3-methoxybenzenesulfonamide (PubChem CID 57386528) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]-3-methoxybenzenesulfonamide.
| Compound Name | N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 57386528 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)NC(C)(C)CCCOCn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C18H25N3O6S/c1-18(2,20-28(24,25)15-7-4-6-14(12-15)26-3)9-5-11-27-13-21-10-8-16(22)19-17(21)23/h4,6-8,10,12,20H,5,9,11,13H2,1-3H3,(H,19,22,23) |
| InChIKey | PYDAKBNJFHKEOT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|