C22H31N3O6S — CID 67022124
3-cyclopentyloxy-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide (PubChem CID 67022124) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide.
| Compound Name | 3-cyclopentyloxy-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67022124 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-cyclopentyloxy-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(CCCOCn1ccc(=O)[nH]c1=O)NS(=O)(=O)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C22H31N3O6S/c1-22(2,12-6-14-30-16-25-13-11-20(26)23-21(25)27)24-32(28,29)19-10-5-9-18(15-19)31-17-7-3-4-8-17/h5,9-11,13,15,17,24H,3-4,6-8,12,14,16H2,1-2H3,(H,23,26,27) |
| InChIKey | NELPOTLJIRGWHD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|