C13H21N3OS — CID 6037975
1,1-dimethyl-3-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)amino]thiourea (PubChem CID 6037975) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)amino]thiourea.
| Compound Name | 1,1-dimethyl-3-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)amino]thiourea |
|---|---|
| PubChem CID | 6037975 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1,1-dimethyl-3-[(E)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)amino]thiourea |
| SMILES | CN(C)C(=S)N/N=C1/C(=O)C2(C)CCC1C2(C)C |
| InChI | InChI=1S/C13H21N3OS/c1-12(2)8-6-7-13(12,3)10(17)9(8)14-15-11(18)16(4)5/h8H,6-7H2,1-5H3,(H,15,18)/b14-9+ |
| InChIKey | ZJWYZMXPINIIGH-NTEUORMPSA-N |
| XLogP | 1.80 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|