C25H27NO5 — CID 6038754
[2-(1H-indol-3-yl)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate (PubChem CID 6038754) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6038754 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OCC(=O)c2c[nH]c3ccccc23)cc1OCC |
| InChI | InChI=1S/C25H27NO5/c1-3-5-14-30-23-12-10-18(15-24(23)29-4-2)11-13-25(28)31-17-22(27)20-16-26-21-9-7-6-8-19(20)21/h6-13,15-16,26H,3-5,14,17H2,1-2H3/b13-11+ |
| InChIKey | ADLHLYHWYHYDQW-ACCUITESSA-N |
| XLogP | 5.18 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|