C20H22N2O5S — CID 6041921
propan-2-yl 4-ethyl-5-methyl-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 6041921) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is propan-2-yl 4-ethyl-5-methyl-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 4-ethyl-5-methyl-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6041921 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | propan-2-yl 4-ethyl-5-methyl-2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)c1C(=O)OC(C)C |
| InChI | InChI=1S/C20H22N2O5S/c1-5-16-13(4)28-19(18(16)20(24)27-12(2)3)21-17(23)10-9-14-7-6-8-15(11-14)22(25)26/h6-12H,5H2,1-4H3,(H,21,23)/b10-9+ |
| InChIKey | FRMGOFKEXBOQPI-MDZDMXLPSA-N |
| XLogP | 4.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|