C20H22N6O2S — CID 6042005
N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 6042005) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 6042005 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[(Z)-1-(4-imidazol-1-ylphenyl)ethylideneamino]-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | C/C(=N/NC(=O)Cc1csc(N2CCOCC2)n1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C20H22N6O2S/c1-15(16-2-4-18(5-3-16)26-7-6-21-14-26)23-24-19(27)12-17-13-29-20(22-17)25-8-10-28-11-9-25/h2-7,13-14H,8-12H2,1H3,(H,24,27)/b23-15- |
| InChIKey | HOSAUSDPWCFZEZ-HAHDFKILSA-N |
| XLogP | 2.25 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|