C16H19F3N2O3 — CID 6043596
4-methoxy-N-[(Z)-(1,1,1-trifluoro-5,5-dimethyl-4-oxohexan-2-ylidene)amino]benzamide (PubChem CID 6043596) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 4-methoxy-N-[(Z)-(1,1,1-trifluoro-5,5-dimethyl-4-oxohexan-2-ylidene)amino]benzamide.
| Compound Name | 4-methoxy-N-[(Z)-(1,1,1-trifluoro-5,5-dimethyl-4-oxohexan-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 6043596 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-methoxy-N-[(Z)-(1,1,1-trifluoro-5,5-dimethyl-4-oxohexan-2-ylidene)amino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C(/CC(=O)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-15(2,3)13(22)9-12(16(17,18)19)20-21-14(23)10-5-7-11(24-4)8-6-10/h5-8H,9H2,1-4H3,(H,21,23)/b20-12- |
| InChIKey | BCXSXCAMQBMMFU-NDENLUEZSA-N |
| XLogP | 3.35 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|