About 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one
3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one (PubChem CID 604685) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one |
| PubChem CID | 604685 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one |
| SMILES | CC1=NNC(=O)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12N2O/c1-7-3-5-9(6-4-7)10-8(2)12-13-11(10)14/h3-6,10H,1-2H3,(H,13,14) |
| InChIKey | UDKOBAZSMCTISD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one?
The IUPAC name of 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one (CID 604685) is 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one?
The canonical SMILES for 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one is CC1=NNC(=O)C1c1ccc(C)cc1.
What is the InChIKey of 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one?
The InChIKey is UDKOBAZSMCTISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-7-3-5-9(6-4-7)10-8(2)12-13-11(10)14/h3-6,10H,1-2H3,(H,13,14).
What are the key properties of 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one?
3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one has a molecular weight of 188.23 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(4-methylphenyl)-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 604685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).