6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid

C13H14N2O4 — CID 604825

IUPAC6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid
SMILESCCCCOc1ccc2[nH]cc(C(=O)O)c(=O)c2n1
InChIInChI=1S/C13H14N2O4/c1-2-3-6-19-10-5-4-9-11(15-10)12(16)8(7-14-9)13(17)18/h4-5,7H,2-3,6H2,1H3,(H,14,16)(H,17,18)
InChIKeyBSMTVNCCCGVRIZ-UHFFFAOYSA-N
MW262.26 g/mol
LogP1.80
Rot. Bonds5

About 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid

6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid (PubChem CID 604825) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid
PubChem CID604825
Molecular FormulaC13H14N2O4
Molecular Weight262.26 g/mol
Exact Mass262.10
IUPAC Name6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid
SMILESCCCCOc1ccc2[nH]cc(C(=O)O)c(=O)c2n1
InChIInChI=1S/C13H14N2O4/c1-2-3-6-19-10-5-4-9-11(15-10)12(16)8(7-14-9)13(17)18/h4-5,7H,2-3,6H2,1H3,(H,14,16)(H,17,18)
InChIKeyBSMTVNCCCGVRIZ-UHFFFAOYSA-N
XLogP1.80
TPSA92.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid?
The IUPAC name of 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid (CID 604825) is 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid?
The canonical SMILES for 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid is CCCCOc1ccc2[nH]cc(C(=O)O)c(=O)c2n1.
What is the InChIKey of 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid?
The InChIKey is BSMTVNCCCGVRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-2-3-6-19-10-5-4-9-11(15-10)12(16)8(7-14-9)13(17)18/h4-5,7H,2-3,6H2,1H3,(H,14,16)(H,17,18).
What are the key properties of 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid?
6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid has a molecular weight of 262.26 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-4-oxo-1H-1,5-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 604825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).