C16H15BrF3N3O2S — CID 60502319
1-(5-bromo-2-pyridinyl)-4-[4-(trifluoromethylsulfonyl)phenyl]piperazine (PubChem CID 60502319) has the molecular formula C16H15BrF3N3O2S and a molecular weight of 450.28 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-4-[4-(trifluoromethylsulfonyl)phenyl]piperazine.
| Compound Name | 1-(5-bromo-2-pyridinyl)-4-[4-(trifluoromethylsulfonyl)phenyl]piperazine |
|---|---|
| PubChem CID | 60502319 |
| Molecular Formula | C16H15BrF3N3O2S |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-4-[4-(trifluoromethylsulfonyl)phenyl]piperazine |
| SMILES | O=S(=O)(c1ccc(N2CCN(c3ccc(Br)cn3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H15BrF3N3O2S/c17-12-1-6-15(21-11-12)23-9-7-22(8-10-23)13-2-4-14(5-3-13)26(24,25)16(18,19)20/h1-6,11H,7-10H2 |
| InChIKey | VLJUSJUCAPOBNA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |