C23H35FN4O3 — CID 60502696
2-[4-[2-[[cyclopentyl-(4-fluorophenyl)methyl]amino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 60502696) has the molecular formula C23H35FN4O3 and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[4-[2-[[cyclopentyl-(4-fluorophenyl)methyl]amino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[2-[[cyclopentyl-(4-fluorophenyl)methyl]amino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 60502696 |
| Molecular Formula | C23H35FN4O3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-[4-[2-[[cyclopentyl-(4-fluorophenyl)methyl]amino]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(CC(=O)NC(c2ccc(F)cc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H35FN4O3/c1-31-15-10-25-21(29)16-27-11-13-28(14-12-27)17-22(30)26-23(18-4-2-3-5-18)19-6-8-20(24)9-7-19/h6-9,18,23H,2-5,10-17H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | CIVDOFKTYLMOHA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|