C24H36N2O2 — CID 86873908
2-(4-cyclohexyloxypiperidin-1-yl)-N-[cyclopropyl-(4-methylphenyl)methyl]acetamide (PubChem CID 86873908) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-(4-cyclohexyloxypiperidin-1-yl)-N-[cyclopropyl-(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-(4-cyclohexyloxypiperidin-1-yl)-N-[cyclopropyl-(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 86873908 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 2-(4-cyclohexyloxypiperidin-1-yl)-N-[cyclopropyl-(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(C(NC(=O)CN2CCC(OC3CCCCC3)CC2)C2CC2)cc1 |
| InChI | InChI=1S/C24H36N2O2/c1-18-7-9-19(10-8-18)24(20-11-12-20)25-23(27)17-26-15-13-22(14-16-26)28-21-5-3-2-4-6-21/h7-10,20-22,24H,2-6,11-17H2,1H3,(H,25,27) |
| InChIKey | BZHANGWUKYOREU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |