C22H34N2O2 — CID 86874095
4-cyclohexyloxy-N-[1-(4-methylphenyl)propyl]piperidine-1-carboxamide (PubChem CID 86874095) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-[1-(4-methylphenyl)propyl]piperidine-1-carboxamide.
| Compound Name | 4-cyclohexyloxy-N-[1-(4-methylphenyl)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86874095 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 4-cyclohexyloxy-N-[1-(4-methylphenyl)propyl]piperidine-1-carboxamide |
| SMILES | CCC(NC(=O)N1CCC(OC2CCCCC2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H34N2O2/c1-3-21(18-11-9-17(2)10-12-18)23-22(25)24-15-13-20(14-16-24)26-19-7-5-4-6-8-19/h9-12,19-21H,3-8,13-16H2,1-2H3,(H,23,25) |
| InChIKey | DFWWUQFJOAFDEL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |