C21H33N3O3 — CID 60503369
N-[2-(4-methoxyphenyl)ethyl]-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetamide (PubChem CID 60503369) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 60503369 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2CCC(CN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O3/c1-26-20-4-2-18(3-5-20)6-9-22-21(25)17-23-10-7-19(8-11-23)16-24-12-14-27-15-13-24/h2-5,19H,6-17H2,1H3,(H,22,25) |
| InChIKey | BKGDOYHQPXCYSZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |