C15H24ClN3O3 — CID 43842037
N-[2-(4-methoxyphenyl)ethyl]-2-(morpholin-4-ylamino)acetamide;hydrochloride (PubChem CID 43842037) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-(morpholin-4-ylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-(morpholin-4-ylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 43842037 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-(morpholin-4-ylamino)acetamide;hydrochloride |
| SMILES | COc1ccc(CCNC(=O)CNN2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3O3.ClH/c1-20-14-4-2-13(3-5-14)6-7-16-15(19)12-17-18-8-10-21-11-9-18;/h2-5,17H,6-12H2,1H3,(H,16,19);1H |
| InChIKey | RJOOCTYIDLDKNZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |