C21H35N3O — CID 60505271
2-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 60505271) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is 2-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 60505271 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 2-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | CCCCN(C)CC1CCN(CC(=O)NCc2ccccc2C)CC1 |
| InChI | InChI=1S/C21H35N3O/c1-4-5-12-23(3)16-19-10-13-24(14-11-19)17-21(25)22-15-20-9-7-6-8-18(20)2/h6-9,19H,4-5,10-17H2,1-3H3,(H,22,25) |
| InChIKey | BUIAIGJYEIWHQC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |