C11H22OSn — CID 6050562
triethyl-[(1E,3E)-4-methoxybuta-1,3-dienyl]stannane (PubChem CID 6050562) has the molecular formula C11H22OSn and a molecular weight of 289.01 g/mol. Its IUPAC name is triethyl-[(1E,3E)-4-methoxybuta-1,3-dienyl]stannane.
| Compound Name | triethyl-[(1E,3E)-4-methoxybuta-1,3-dienyl]stannane |
|---|---|
| PubChem CID | 6050562 |
| Molecular Formula | C11H22OSn |
| Molecular Weight | 289.01 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | triethyl-[(1E,3E)-4-methoxybuta-1,3-dienyl]stannane |
| SMILES | CC[Sn](/C=C/C=C/OC)(CC)CC |
| InChI | InChI=1S/C5H7O.3C2H5.Sn/c1-3-4-5-6-2;3*1-2;/h1,3-5H,2H3;3*1H2,2H3;/b3-1?,5-4+;;;; |
| InChIKey | NIPDMDGBUMPDID-JPPHFFHZSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.01 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|