C18H26FN3O3 — CID 60506939
2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-(2-methylpropyl)amino]acetamide (PubChem CID 60506939) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 60506939 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)CC(=O)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H26FN3O3/c1-13(2)9-21(11-17(20)23)12-18(24)22-7-8-25-16(10-22)14-3-5-15(19)6-4-14/h3-6,13,16H,7-12H2,1-2H3,(H2,20,23) |
| InChIKey | PJVQAHIROBFACJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |