C18H24FN3O3 — CID 87014183
N-cyclopropyl-2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-methylamino]acetamide (PubChem CID 87014183) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 87014183 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-cyclopropyl-2-[[2-[2-(4-fluorophenyl)morpholin-4-yl]-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)CC(=O)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H24FN3O3/c1-21(11-17(23)20-15-6-7-15)12-18(24)22-8-9-25-16(10-22)13-2-4-14(19)5-3-13/h2-5,15-16H,6-12H2,1H3,(H,20,23) |
| InChIKey | HGWIKDZXNWDRLC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |