C20H29N3O2 — CID 60508350
5,5-dimethyl-3-[3-(6-propan-2-yl-3,4-dihydro-2H-quinolin-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 60508350) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-(6-propan-2-yl-3,4-dihydro-2H-quinolin-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[3-(6-propan-2-yl-3,4-dihydro-2H-quinolin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60508350 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 5,5-dimethyl-3-[3-(6-propan-2-yl-3,4-dihydro-2H-quinolin-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc2c(c1)CCCN2CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C20H29N3O2/c1-14(2)15-8-9-17-16(13-15)7-5-10-22(17)11-6-12-23-18(24)20(3,4)21-19(23)25/h8-9,13-14H,5-7,10-12H2,1-4H3,(H,21,25) |
| InChIKey | LGRCHDXOKYNNIV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|