C23H22FN3OS — CID 60509420
N-(4-cyclopentylsulfanylphenyl)-2-(3-fluoroanilino)pyridine-3-carboxamide (PubChem CID 60509420) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-2-(3-fluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-2-(3-fluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60509420 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-2-(3-fluoroanilino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(SC2CCCC2)cc1)c1cccnc1Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H22FN3OS/c24-16-5-3-6-18(15-16)26-22-21(9-4-14-25-22)23(28)27-17-10-12-20(13-11-17)29-19-7-1-2-8-19/h3-6,9-15,19H,1-2,7-8H2,(H,25,26)(H,27,28) |
| InChIKey | PBQHLTGYPJRKDR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |