C25H32N4O3 — CID 60512394
tert-butyl N-[1-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 60512394) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 60512394 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | COc1ccc(-n2c(CN3CCC(NC(=O)OC(C)(C)C)CC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-25(2,3)32-24(30)26-18-13-15-28(16-14-18)17-23-27-21-7-5-6-8-22(21)29(23)19-9-11-20(31-4)12-10-19/h5-12,18H,13-17H2,1-4H3,(H,26,30) |
| InChIKey | BPNTZRQAKVNXDI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |