C15H17N5O2S2 — CID 6051241
(E)-3-(4-methoxyphenyl)-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]prop-2-enamide (PubChem CID 6051241) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6051241 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nn2c(C)nnc2SC)cc1 |
| InChI | InChI=1S/C15H17N5O2S2/c1-10-17-18-15(24-3)20(10)19-14(23)16-13(21)9-6-11-4-7-12(22-2)8-5-11/h4-9H,1-3H3,(H2,16,19,21,23)/b9-6+ |
| InChIKey | MUBGRBHIAWFKGV-RMKNXTFCSA-N |
| XLogP | 1.98 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|