C13H14ClN5O2S2 — CID 4036777
5-chloro-2-methoxy-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide (PubChem CID 4036777) has the molecular formula C13H14ClN5O2S2 and a molecular weight of 371.88 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4036777 |
| Molecular Formula | C13H14ClN5O2S2 |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nn1c(C)nnc1SC |
| InChI | InChI=1S/C13H14ClN5O2S2/c1-7-16-17-13(23-3)19(7)18-12(22)15-11(20)9-6-8(14)4-5-10(9)21-2/h4-6H,1-3H3,(H2,15,18,20,22) |
| InChIKey | DQVWOQCIUHGOJT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|