C13H14N6O3S2 — CID 3528320
2-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-3-nitrobenzamide (PubChem CID 3528320) has the molecular formula C13H14N6O3S2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-3-nitrobenzamide.
| Compound Name | 2-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3528320 |
| Molecular Formula | C13H14N6O3S2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-3-nitrobenzamide |
| SMILES | CSc1nnc(C)n1NC(=S)NC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H14N6O3S2/c1-7-9(5-4-6-10(7)19(21)22)11(20)14-12(23)17-18-8(2)15-16-13(18)24-3/h4-6H,1-3H3,(H2,14,17,20,23) |
| InChIKey | FEQSXTMPUJHWPI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|