C13H15N5OS2 — CID 3498239
3-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide (PubChem CID 3498239) has the molecular formula C13H15N5OS2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide.
| Compound Name | 3-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3498239 |
| Molecular Formula | C13H15N5OS2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 3-methyl-N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]benzamide |
| SMILES | CSc1nnc(C)n1NC(=S)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C13H15N5OS2/c1-8-5-4-6-10(7-8)11(19)14-12(20)17-18-9(2)15-16-13(18)21-3/h4-7H,1-3H3,(H2,14,17,19,20) |
| InChIKey | JCNATOWUYBBBEZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|