C12H12N6O3S2 — CID 3594185
N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-2-nitrobenzamide (PubChem CID 3594185) has the molecular formula C12H12N6O3S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 3594185 |
| Molecular Formula | C12H12N6O3S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-[(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)carbamothioyl]-2-nitrobenzamide |
| SMILES | CSc1nnc(C)n1NC(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N6O3S2/c1-7-14-15-12(23-2)17(7)16-11(22)13-10(19)8-5-3-4-6-9(8)18(20)21/h3-6H,1-2H3,(H2,13,16,19,22) |
| InChIKey | MPDVKIMULAVNGI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|