C14H15Br2N5O2S2 — CID 5236414
3,5-dibromo-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-methoxybenzamide (PubChem CID 5236414) has the molecular formula C14H15Br2N5O2S2 and a molecular weight of 509.25 g/mol. Its IUPAC name is 3,5-dibromo-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 5236414 |
| Molecular Formula | C14H15Br2N5O2S2 |
| Molecular Weight | 509.25 g/mol |
| Exact Mass | 506.90 |
| IUPAC Name | 3,5-dibromo-N-[(3-ethylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-methoxybenzamide |
| SMILES | CCSc1nnc(C)n1NC(=S)NC(=O)c1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C14H15Br2N5O2S2/c1-4-25-14-19-18-7(2)21(14)20-13(24)17-12(22)9-5-8(15)6-10(16)11(9)23-3/h5-6H,4H2,1-3H3,(H2,17,20,22,24) |
| InChIKey | FSVCXLCRPLEMPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|