C17H30N4O2S — CID 60513100
N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(oxolan-2-yl)propanamide (PubChem CID 60513100) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(oxolan-2-yl)propanamide.
| Compound Name | N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 60513100 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-3-(oxolan-2-yl)propanamide |
| SMILES | CSc1nnc(CCCNC(=O)CCC2CCCO2)n1CC(C)C |
| InChI | InChI=1S/C17H30N4O2S/c1-13(2)12-21-15(19-20-17(21)24-3)7-4-10-18-16(22)9-8-14-6-5-11-23-14/h13-14H,4-12H2,1-3H3,(H,18,22) |
| InChIKey | LTZSJHNGWYMIQU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|