C26H28FN3O3 — CID 60516358
4-butoxy-N-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]benzamide (PubChem CID 60516358) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-butoxy-N-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 60516358 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-butoxy-N-[2-[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)N2CC=C(c3c[nH]c4cc(F)ccc34)CC2)cc1 |
| InChI | InChI=1S/C26H28FN3O3/c1-2-3-14-33-21-7-4-19(5-8-21)26(32)29-17-25(31)30-12-10-18(11-13-30)23-16-28-24-15-20(27)6-9-22(23)24/h4-10,15-16,28H,2-3,11-14,17H2,1H3,(H,29,32) |
| InChIKey | HPTZDNZDAXJSQE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|