C25H31N3O2 — CID 60517352
N-(2-methoxy-5-methylphenyl)-2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]propanamide (PubChem CID 60517352) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]propanamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 60517352 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]propanamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(C)N1CCC(c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H31N3O2/c1-16-9-10-23(30-4)22(15-16)27-25(29)18(3)28-13-11-19(12-14-28)24-17(2)26-21-8-6-5-7-20(21)24/h5-10,15,18-19,26H,11-14H2,1-4H3,(H,27,29) |
| InChIKey | HXDYAXDGAZWREU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|