C15H14N4O5 — CID 60517415
1-ethyl-3-[2-(2-nitrophenoxy)ethyl]-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 60517415) has the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-nitrophenoxy)ethyl]-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-ethyl-3-[2-(2-nitrophenoxy)ethyl]-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 60517415 |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-ethyl-3-[2-(2-nitrophenoxy)ethyl]-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCn1cc(C#N)c(=O)n(CCOc2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C15H14N4O5/c1-2-17-10-11(9-16)14(20)18(15(17)21)7-8-24-13-6-4-3-5-12(13)19(22)23/h3-6,10H,2,7-8H2,1H3 |
| InChIKey | KMDZYLBXRHFBDE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 120.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|