C15H15N3O3 — CID 63800667
2-[2-(3-ethyl-2,6-dioxopyrimidin-1-yl)ethoxy]benzonitrile (PubChem CID 63800667) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[2-(3-ethyl-2,6-dioxopyrimidin-1-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-(3-ethyl-2,6-dioxopyrimidin-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 63800667 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[2-(3-ethyl-2,6-dioxopyrimidin-1-yl)ethoxy]benzonitrile |
| SMILES | CCn1ccc(=O)n(CCOc2ccccc2C#N)c1=O |
| InChI | InChI=1S/C15H15N3O3/c1-2-17-8-7-14(19)18(15(17)20)9-10-21-13-6-4-3-5-12(13)11-16/h3-8H,2,9-10H2,1H3 |
| InChIKey | RTIJXXUUQPYBNR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |