C19H15N3O2S2 — CID 60518587
5-[2-(1H-indol-3-yl)-2-oxoethyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 60518587) has the molecular formula C19H15N3O2S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)-2-oxoethyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[2-(1H-indol-3-yl)-2-oxoethyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 60518587 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)-2-oxoethyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=C(Cc1nc2sc3c(c2c(=O)[nH]1)CCCS3)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H15N3O2S2/c23-14(12-9-20-13-6-2-1-4-10(12)13)8-15-21-17(24)16-11-5-3-7-25-19(11)26-18(16)22-15/h1-2,4,6,9,20H,3,5,7-8H2,(H,21,22,24) |
| InChIKey | RVVVJQVJFOOVFM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |