C16H17N3OS3 — CID 60562248
5-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 60562248) has the molecular formula C16H17N3OS3 and a molecular weight of 363.53 g/mol. Its IUPAC name is 5-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 60562248 |
| Molecular Formula | C16H17N3OS3 |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-8,10-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CC(C)c1nc(Cc2nc3sc4c(c3c(=O)[nH]2)CCCS4)cs1 |
| InChI | InChI=1S/C16H17N3OS3/c1-8(2)14-17-9(7-22-14)6-11-18-13(20)12-10-4-3-5-21-16(10)23-15(12)19-11/h7-8H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | ZTLFGYKNORBTKA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |