C21H23N3O3 — CID 60519723
2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-[1-(4-ethylphenyl)ethyl]acetamide (PubChem CID 60519723) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-[1-(4-ethylphenyl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-[1-(4-ethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 60519723 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-[1-(4-ethylphenyl)ethyl]acetamide |
| SMILES | CCc1ccc(C(C)NC(=O)CN2C(=O)CN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-3-16-9-11-17(12-10-16)15(2)22-19(25)13-24-20(26)14-23(21(24)27)18-7-5-4-6-8-18/h4-12,15H,3,13-14H2,1-2H3,(H,22,25) |
| InChIKey | MSPKQTXYMJLVJH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|