C18H18BrNO3 — CID 60522384
N-[4-[2-(3-bromophenoxy)ethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 60522384) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is N-[4-[2-(3-bromophenoxy)ethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-(3-bromophenoxy)ethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60522384 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[4-[2-(3-bromophenoxy)ethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(OCCOc2cccc(Br)c2)cc1)C1CC1 |
| InChI | InChI=1S/C18H18BrNO3/c19-14-2-1-3-17(12-14)23-11-10-22-16-8-6-15(7-9-16)20-18(21)13-4-5-13/h1-3,6-9,12-13H,4-5,10-11H2,(H,20,21) |
| InChIKey | LGKPUMSRZJPQAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|