C15H20BrNO3 — CID 60809216
4-[2-(3-bromophenoxy)ethylamino]cyclohexane-1-carboxylic acid (PubChem CID 60809216) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is 4-[2-(3-bromophenoxy)ethylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(3-bromophenoxy)ethylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 60809216 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-[2-(3-bromophenoxy)ethylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCCOc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H20BrNO3/c16-12-2-1-3-14(10-12)20-9-8-17-13-6-4-11(5-7-13)15(18)19/h1-3,10-11,13,17H,4-9H2,(H,18,19) |
| InChIKey | RGIBKCUJYNINTG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|