C12H17NO3S — CID 60523237
2-[2-(2-methylphenoxy)ethyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 60523237) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-[2-(2-methylphenoxy)ethyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[2-(2-methylphenoxy)ethyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 60523237 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[2-(2-methylphenoxy)ethyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | Cc1ccccc1OCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C12H17NO3S/c1-11-5-2-3-6-12(11)16-9-8-13-7-4-10-17(13,14)15/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | MHPOSGBRODWEAN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |