C19H17F3N2O2S2 — CID 60524129
11-methyl-10-[[4-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 60524129) has the molecular formula C19H17F3N2O2S2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 11-methyl-10-[[4-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 11-methyl-10-[[4-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 60524129 |
| Molecular Formula | C19H17F3N2O2S2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 11-methyl-10-[[4-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Cn1c(SCc2ccc(OCC(F)(F)F)cc2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C19H17F3N2O2S2/c1-24-17(25)15-13-3-2-4-14(13)28-16(15)23-18(24)27-9-11-5-7-12(8-6-11)26-10-19(20,21)22/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | VFHPNMUXJWBAGQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |