C22H17F3N4O4 — CID 60524221
4-[[4-benzamido-2-(trifluoromethyl)anilino]methyl]-3-nitrobenzamide (PubChem CID 60524221) has the molecular formula C22H17F3N4O4 and a molecular weight of 458.40 g/mol. Its IUPAC name is 4-[[4-benzamido-2-(trifluoromethyl)anilino]methyl]-3-nitrobenzamide.
| Compound Name | 4-[[4-benzamido-2-(trifluoromethyl)anilino]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 60524221 |
| Molecular Formula | C22H17F3N4O4 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-[[4-benzamido-2-(trifluoromethyl)anilino]methyl]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(CNc2ccc(NC(=O)c3ccccc3)cc2C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17F3N4O4/c23-22(24,25)17-11-16(28-21(31)13-4-2-1-3-5-13)8-9-18(17)27-12-15-7-6-14(20(26)30)10-19(15)29(32)33/h1-11,27H,12H2,(H2,26,30)(H,28,31) |
| InChIKey | VGJALSSWWHZSGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|