C24H21F3N4O3 — CID 60587785
N-[4-[[2-(benzylcarbamoylamino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 60587785) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is N-[4-[[2-(benzylcarbamoylamino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[[2-(benzylcarbamoylamino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 60587785 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[4-[[2-(benzylcarbamoylamino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CNc1ccc(NC(=O)c2ccccc2)cc1C(F)(F)F)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H21F3N4O3/c25-24(26,27)19-13-18(30-22(33)17-9-5-2-6-10-17)11-12-20(19)28-15-21(32)31-23(34)29-14-16-7-3-1-4-8-16/h1-13,28H,14-15H2,(H,30,33)(H2,29,31,32,34) |
| InChIKey | HDMGWEBBTXGVIC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |