C23H21F3N4O3 — CID 55743685
N-[4-[(2-ethoxy-3-pyridinyl)methylcarbamoylamino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 55743685) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[4-[(2-ethoxy-3-pyridinyl)methylcarbamoylamino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[(2-ethoxy-3-pyridinyl)methylcarbamoylamino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55743685 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[4-[(2-ethoxy-3-pyridinyl)methylcarbamoylamino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1ncccc1CNC(=O)Nc1ccc(NC(=O)c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N4O3/c1-2-33-21-16(9-6-12-27-21)14-28-22(32)30-19-11-10-17(13-18(19)23(24,25)26)29-20(31)15-7-4-3-5-8-15/h3-13H,2,14H2,1H3,(H,29,31)(H2,28,30,32) |
| InChIKey | OMCQHUAEJULHLB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |