C16H18ClN3O3 — CID 86862849
1-(2-chloro-4-methoxyphenyl)-3-[(2-ethoxy-3-pyridinyl)methyl]urea (PubChem CID 86862849) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenyl)-3-[(2-ethoxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-(2-chloro-4-methoxyphenyl)-3-[(2-ethoxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 86862849 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenyl)-3-[(2-ethoxy-3-pyridinyl)methyl]urea |
| SMILES | CCOc1ncccc1CNC(=O)Nc1ccc(OC)cc1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-3-23-15-11(5-4-8-18-15)10-19-16(21)20-14-7-6-12(22-2)9-13(14)17/h4-9H,3,10H2,1-2H3,(H2,19,20,21) |
| InChIKey | IOSVOSURAFHLET-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |