C20H17F3N4O4 — CID 119037443
N-[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 119037443) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 119037443 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN1C(=O)CC(NC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C20H17F3N4O4/c1-27-16(28)10-15(18(27)30)26-19(31)25-14-8-7-12(9-13(14)20(21,22)23)24-17(29)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3,(H,24,29)(H2,25,26,31) |
| InChIKey | WHFPWMYWFXUOHU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|