C26H25F3N4O3 — CID 60524314
N-[4-[[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 60524314) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is N-[4-[[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 60524314 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[4-[[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CNc1ccc(NC(=O)c2ccccc2)cc1C(F)(F)F)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H25F3N4O3/c27-26(28,29)22-16-20(32-25(35)18-4-2-1-3-5-18)8-11-23(22)30-17-24(34)31-19-6-9-21(10-7-19)33-12-14-36-15-13-33/h1-11,16,30H,12-15,17H2,(H,31,34)(H,32,35) |
| InChIKey | FIMUDHOWKCMRTH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|