C15H19N5O2 — CID 60525175
2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-(4-ethylphenyl)acetamide (PubChem CID 60525175) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 60525175 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CO/N=C(/N)c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-3-11-4-6-13(7-5-11)18-14(21)10-22-19-15(16)12-8-17-20(2)9-12/h4-9H,3,10H2,1-2H3,(H2,16,19)(H,18,21) |
| InChIKey | PIHCOZYPYJLUAS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|