C17H24N6O4S — CID 51961196
2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 51961196) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51961196 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[(E)-[amino-(1-methylpyrazol-4-yl)methylidene]amino]oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CO/N=C(/N)c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C17H24N6O4S/c1-4-23(5-2)28(25,26)15-8-6-14(7-9-15)20-16(24)12-27-21-17(18)13-10-19-22(3)11-13/h6-11H,4-5,12H2,1-3H3,(H2,18,21)(H,20,24) |
| InChIKey | WRONEZSBCFMLDF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|